C15H19ClN2O4 — CID 43971326
3-chloro-N-[1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]propanamide (PubChem CID 43971326) has the molecular formula C15H19ClN2O4 and a molecular weight of 326.78 g/mol. Its IUPAC name is 3-chloro-N-[1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]propanamide.
| Compound Name | 3-chloro-N-[1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 43971326 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 3-chloro-N-[1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]propanamide |
| SMILES | COc1ccc(N2CC(NC(=O)CCCl)CC2=O)cc1OC |
| InChI | InChI=1S/C15H19ClN2O4/c1-21-12-4-3-11(8-13(12)22-2)18-9-10(7-15(18)20)17-14(19)5-6-16/h3-4,8,10H,5-7,9H2,1-2H3,(H,17,19) |
| InChIKey | FGSFSWPPJAKUDW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|