C25H23N3O2 — CID 43976657
N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-3,3-diphenylpropanamide (PubChem CID 43976657) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-3,3-diphenylpropanamide.
| Compound Name | N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 43976657 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-3,3-diphenylpropanamide |
| SMILES | Cc1cc(C)cc(-c2nnc(NC(=O)CC(c3ccccc3)c3ccccc3)o2)c1 |
| InChI | InChI=1S/C25H23N3O2/c1-17-13-18(2)15-21(14-17)24-27-28-25(30-24)26-23(29)16-22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-15,22H,16H2,1-2H3,(H,26,28,29) |
| InChIKey | FTIULVWIRATNDB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |