C13H6Cl2N4O4S — CID 43976962
N-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]-5-nitrothiophene-2-carboxamide (PubChem CID 43976962) has the molecular formula C13H6Cl2N4O4S and a molecular weight of 385.19 g/mol. Its IUPAC name is N-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]-5-nitrothiophene-2-carboxamide.
| Compound Name | N-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 43976962 |
| Molecular Formula | C13H6Cl2N4O4S |
| Molecular Weight | 385.19 g/mol |
| Exact Mass | 383.95 |
| IUPAC Name | N-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]-5-nitrothiophene-2-carboxamide |
| SMILES | O=C(Nc1nnc(-c2ccc(Cl)cc2Cl)o1)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C13H6Cl2N4O4S/c14-6-1-2-7(8(15)5-6)12-17-18-13(23-12)16-11(20)9-3-4-10(24-9)19(21)22/h1-5H,(H,16,18,20) |
| InChIKey | XJBARLDIBIJAKX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.19 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|