C17H13F2N3O4S — CID 43977940
N-[5-(4-ethylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]-2,4-difluorobenzamide (PubChem CID 43977940) has the molecular formula C17H13F2N3O4S and a molecular weight of 393.37 g/mol. Its IUPAC name is N-[5-(4-ethylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]-2,4-difluorobenzamide.
| Compound Name | N-[5-(4-ethylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 43977940 |
| Molecular Formula | C17H13F2N3O4S |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-[5-(4-ethylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]-2,4-difluorobenzamide |
| SMILES | CCS(=O)(=O)c1ccc(-c2nnc(NC(=O)c3ccc(F)cc3F)o2)cc1 |
| InChI | InChI=1S/C17H13F2N3O4S/c1-2-27(24,25)12-6-3-10(4-7-12)16-21-22-17(26-16)20-15(23)13-8-5-11(18)9-14(13)19/h3-9H,2H2,1H3,(H,20,22,23) |
| InChIKey | RQRDWZSEWSWQHK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |