C17H13Cl2N3O4S — CID 43977959
2,4-dichloro-N-[5-(4-ethylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 43977959) has the molecular formula C17H13Cl2N3O4S and a molecular weight of 426.28 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-(4-ethylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-(4-ethylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 43977959 |
| Molecular Formula | C17H13Cl2N3O4S |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 2,4-dichloro-N-[5-(4-ethylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | CCS(=O)(=O)c1ccc(-c2nnc(NC(=O)c3ccc(Cl)cc3Cl)o2)cc1 |
| InChI | InChI=1S/C17H13Cl2N3O4S/c1-2-27(24,25)12-6-3-10(4-7-12)16-21-22-17(26-16)20-15(23)13-8-5-11(18)9-14(13)19/h3-9H,2H2,1H3,(H,20,22,23) |
| InChIKey | GJGRSZAWQDTTRQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |