C23H22N2O7S — CID 43979193
ethyl 3-[2-(2,3-dihydro-1,4-benzodioxine-3-carbonylimino)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-3-yl]propanoate (PubChem CID 43979193) has the molecular formula C23H22N2O7S and a molecular weight of 470.50 g/mol. Its IUPAC name is ethyl 3-[2-(2,3-dihydro-1,4-benzodioxine-3-carbonylimino)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-3-yl]propanoate.
| Compound Name | ethyl 3-[2-(2,3-dihydro-1,4-benzodioxine-3-carbonylimino)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-3-yl]propanoate |
|---|---|
| PubChem CID | 43979193 |
| Molecular Formula | C23H22N2O7S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | ethyl 3-[2-(2,3-dihydro-1,4-benzodioxine-3-carbonylimino)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-3-yl]propanoate |
| SMILES | CCOC(=O)CCn1/c(=N/C(=O)C2COc3ccccc3O2)sc2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C23H22N2O7S/c1-2-28-21(26)7-8-25-14-11-17-18(30-10-9-29-17)12-20(14)33-23(25)24-22(27)19-13-31-15-5-3-4-6-16(15)32-19/h3-6,11-12,19H,2,7-10,13H2,1H3/b24-23- |
| InChIKey | PJNBXPZZKJBLCI-VHXPQNKSSA-N |
| XLogP | 2.69 |
| TPSA | 97.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |