C20H17N3O7S — CID 5187239
ethyl 2-[2-(2,3-dihydro-1,4-benzodioxine-3-carbonylimino)-6-nitro-1,3-benzothiazol-3-yl]acetate (PubChem CID 5187239) has the molecular formula C20H17N3O7S and a molecular weight of 443.44 g/mol. Its IUPAC name is ethyl 2-[2-(2,3-dihydro-1,4-benzodioxine-3-carbonylimino)-6-nitro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(2,3-dihydro-1,4-benzodioxine-3-carbonylimino)-6-nitro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 5187239 |
| Molecular Formula | C20H17N3O7S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | ethyl 2-[2-(2,3-dihydro-1,4-benzodioxine-3-carbonylimino)-6-nitro-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)C2COc3ccccc3O2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H17N3O7S/c1-2-28-18(24)10-22-13-8-7-12(23(26)27)9-17(13)31-20(22)21-19(25)16-11-29-14-5-3-4-6-15(14)30-16/h3-9,16H,2,10-11H2,1H3/b21-20- |
| InChIKey | GZOQETDYNFGXCF-MRCUWXFGSA-N |
| XLogP | 2.44 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|