C21H20N2OS2 — CID 43980772
2-methylsulfanyl-N-(6-propan-2-yl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43980772) has the molecular formula C21H20N2OS2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 2-methylsulfanyl-N-(6-propan-2-yl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 2-methylsulfanyl-N-(6-propan-2-yl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43980772 |
| Molecular Formula | C21H20N2OS2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-methylsulfanyl-N-(6-propan-2-yl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccccc2SC)sc2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C21H20N2OS2/c1-5-12-23-17-11-10-15(14(2)3)13-19(17)26-21(23)22-20(24)16-8-6-7-9-18(16)25-4/h1,6-11,13-14H,12H2,2-4H3/b22-21- |
| InChIKey | RJKOBIJCEBFNCT-DQRAZIAOSA-N |
| XLogP | 4.92 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|