C21H22N4O3S — CID 43982621
[4-(5,7-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-methyl-3-nitrophenyl)methanone (PubChem CID 43982621) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is [4-(5,7-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-methyl-3-nitrophenyl)methanone.
| Compound Name | [4-(5,7-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-methyl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 43982621 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | [4-(5,7-dimethyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-(2-methyl-3-nitrophenyl)methanone |
| SMILES | Cc1cc(C)c2sc(N3CCN(C(=O)c4cccc([N+](=O)[O-])c4C)CC3)nc2c1 |
| InChI | InChI=1S/C21H22N4O3S/c1-13-11-14(2)19-17(12-13)22-21(29-19)24-9-7-23(8-10-24)20(26)16-5-4-6-18(15(16)3)25(27)28/h4-6,11-12H,7-10H2,1-3H3 |
| InChIKey | VCJULKWLSIZZSR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|