C24H24N4O3S — CID 41116489
1-[3-[4-(5,7-dimethyl-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]phenyl]pyrrolidine-2,5-dione (PubChem CID 41116489) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is 1-[3-[4-(5,7-dimethyl-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3-[4-(5,7-dimethyl-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 41116489 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 1-[3-[4-(5,7-dimethyl-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]phenyl]pyrrolidine-2,5-dione |
| SMILES | Cc1cc(C)c2sc(N3CCN(C(=O)c4cccc(N5C(=O)CCC5=O)c4)CC3)nc2c1 |
| InChI | InChI=1S/C24H24N4O3S/c1-15-12-16(2)22-19(13-15)25-24(32-22)27-10-8-26(9-11-27)23(31)17-4-3-5-18(14-17)28-20(29)6-7-21(28)30/h3-5,12-14H,6-11H2,1-2H3 |
| InChIKey | JNNMCASSWNINQR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|