C22H18F2N4O3S — CID 41116420
1-[3-[4-(4,6-difluoro-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]phenyl]pyrrolidine-2,5-dione (PubChem CID 41116420) has the molecular formula C22H18F2N4O3S and a molecular weight of 456.47 g/mol. Its IUPAC name is 1-[3-[4-(4,6-difluoro-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3-[4-(4,6-difluoro-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 41116420 |
| Molecular Formula | C22H18F2N4O3S |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 1-[3-[4-(4,6-difluoro-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C(c1cccc(N2C(=O)CCC2=O)c1)N1CCN(c2nc3c(F)cc(F)cc3s2)CC1 |
| InChI | InChI=1S/C22H18F2N4O3S/c23-14-11-16(24)20-17(12-14)32-22(25-20)27-8-6-26(7-9-27)21(31)13-2-1-3-15(10-13)28-18(29)4-5-19(28)30/h1-3,10-12H,4-9H2 |
| InChIKey | YZOAAJBYSHNDGU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|