C24H25ClN4O2 — CID 43991488
2-(2-chlorophenoxy)-N-[3-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]acetamide (PubChem CID 43991488) has the molecular formula C24H25ClN4O2 and a molecular weight of 436.94 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[3-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[3-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 43991488 |
| Molecular Formula | C24H25ClN4O2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[3-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]acetamide |
| SMILES | CC1CCN(c2ccc(-c3cccc(NC(=O)COc4ccccc4Cl)c3)nn2)CC1 |
| InChI | InChI=1S/C24H25ClN4O2/c1-17-11-13-29(14-12-17)23-10-9-21(27-28-23)18-5-4-6-19(15-18)26-24(30)16-31-22-8-3-2-7-20(22)25/h2-10,15,17H,11-14,16H2,1H3,(H,26,30) |
| InChIKey | KEPIJHBXGQOUTA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |