C28H34N4O2 — CID 43991479
2-(4-tert-butylphenoxy)-N-[3-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]acetamide (PubChem CID 43991479) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[3-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[3-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 43991479 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[3-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]acetamide |
| SMILES | CC1CCN(c2ccc(-c3cccc(NC(=O)COc4ccc(C(C)(C)C)cc4)c3)nn2)CC1 |
| InChI | InChI=1S/C28H34N4O2/c1-20-14-16-32(17-15-20)26-13-12-25(30-31-26)21-6-5-7-23(18-21)29-27(33)19-34-24-10-8-22(9-11-24)28(2,3)4/h5-13,18,20H,14-17,19H2,1-4H3,(H,29,33) |
| InChIKey | OTBKQQAQLFEDSL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |