C24H27N5O — CID 43991572
1-(2-methylphenyl)-3-[3-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]urea (PubChem CID 43991572) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[3-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]urea.
| Compound Name | 1-(2-methylphenyl)-3-[3-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 43991572 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 1-(2-methylphenyl)-3-[3-[6-(4-methylpiperidin-1-yl)pyridazin-3-yl]phenyl]urea |
| SMILES | Cc1ccccc1NC(=O)Nc1cccc(-c2ccc(N3CCC(C)CC3)nn2)c1 |
| InChI | InChI=1S/C24H27N5O/c1-17-12-14-29(15-13-17)23-11-10-22(27-28-23)19-7-5-8-20(16-19)25-24(30)26-21-9-4-3-6-18(21)2/h3-11,16-17H,12-15H2,1-2H3,(H2,25,26,30) |
| InChIKey | FOJGGWZUEIWHGE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |