C18H13ClN2O4S — CID 43994641
(Z)-3-(1,3-benzodioxol-5-yl)-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 43994641) has the molecular formula C18H13ClN2O4S and a molecular weight of 388.83 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-5-yl)-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 43994641 |
| Molecular Formula | C18H13ClN2O4S |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | COc1ccc(Cl)c2sc(NC(=O)/C=C\c3ccc4c(c3)OCO4)nc12 |
| InChI | InChI=1S/C18H13ClN2O4S/c1-23-13-6-4-11(19)17-16(13)21-18(26-17)20-15(22)7-3-10-2-5-12-14(8-10)25-9-24-12/h2-8H,9H2,1H3,(H,20,21,22)/b7-3- |
| InChIKey | XUCRXWNDSFVGTQ-CLTKARDFSA-N |
| XLogP | 4.34 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|