C21H17N5O3S — CID 43996050
1-[(4-methylphenyl)methyl]-2-oxo-N-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)-1,8-naphthyridine-3-carboxamide (PubChem CID 43996050) has the molecular formula C21H17N5O3S and a molecular weight of 419.47 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-2-oxo-N-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-[(4-methylphenyl)methyl]-2-oxo-N-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 43996050 |
| Molecular Formula | C21H17N5O3S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-2-oxo-N-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)-1,8-naphthyridine-3-carboxamide |
| SMILES | Cc1ccc(Cn2c(=O)c(C(=O)Nc3cc(=O)[nH]c(=S)[nH]3)cc3cccnc32)cc1 |
| InChI | InChI=1S/C21H17N5O3S/c1-12-4-6-13(7-5-12)11-26-18-14(3-2-8-22-18)9-15(20(26)29)19(28)23-16-10-17(27)25-21(30)24-16/h2-10H,11H2,1H3,(H3,23,24,25,27,28,30) |
| InChIKey | OHBUMTQNTNFOSW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|