C26H21N5O3 — CID 43996027
1-[(4-methylphenyl)methyl]-2-oxo-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-1,8-naphthyridine-3-carboxamide (PubChem CID 43996027) has the molecular formula C26H21N5O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-2-oxo-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-[(4-methylphenyl)methyl]-2-oxo-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 43996027 |
| Molecular Formula | C26H21N5O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-2-oxo-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-1,8-naphthyridine-3-carboxamide |
| SMILES | Cc1ccc(Cn2c(=O)c(C(=O)NC3=NN(c4ccccc4)C(=O)C3)cc3cccnc32)cc1 |
| InChI | InChI=1S/C26H21N5O3/c1-17-9-11-18(12-10-17)16-30-24-19(6-5-13-27-24)14-21(26(30)34)25(33)28-22-15-23(32)31(29-22)20-7-3-2-4-8-20/h2-14H,15-16H2,1H3,(H,28,29,33) |
| InChIKey | YKMNHBUWFKQVIO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'} |
|---|