C26H25N3O2 — CID 7620499
1-[(4-methylphenyl)methyl]-2-oxo-N-(3-phenylpropyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 7620499) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-2-oxo-N-(3-phenylpropyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-[(4-methylphenyl)methyl]-2-oxo-N-(3-phenylpropyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 7620499 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-2-oxo-N-(3-phenylpropyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | Cc1ccc(Cn2c(=O)c(C(=O)NCCCc3ccccc3)cc3cccnc32)cc1 |
| InChI | InChI=1S/C26H25N3O2/c1-19-11-13-21(14-12-19)18-29-24-22(10-6-15-27-24)17-23(26(29)31)25(30)28-16-5-9-20-7-3-2-4-8-20/h2-4,6-8,10-15,17H,5,9,16,18H2,1H3,(H,28,30) |
| InChIKey | LJBFVAPZXXJVMQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|