C21H24N4O2 — CID 7620123
1-benzyl-N-[3-(dimethylamino)propyl]-2-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 7620123) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-benzyl-N-[3-(dimethylamino)propyl]-2-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-benzyl-N-[3-(dimethylamino)propyl]-2-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 7620123 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-benzyl-N-[3-(dimethylamino)propyl]-2-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cc2cccnc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C21H24N4O2/c1-24(2)13-7-12-23-20(26)18-14-17-10-6-11-22-19(17)25(21(18)27)15-16-8-4-3-5-9-16/h3-6,8-11,14H,7,12-13,15H2,1-2H3,(H,23,26) |
| InChIKey | TWSGFMVQPWFXBM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|