C24H28ClN3O2 — CID 43996348
1-[(4-chlorophenyl)methyl]-N-octyl-2-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 43996348) has the molecular formula C24H28ClN3O2 and a molecular weight of 425.96 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-octyl-2-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-octyl-2-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 43996348 |
| Molecular Formula | C24H28ClN3O2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-octyl-2-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | CCCCCCCCNC(=O)c1cc2cccnc2n(Cc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C24H28ClN3O2/c1-2-3-4-5-6-7-14-27-23(29)21-16-19-9-8-15-26-22(19)28(24(21)30)17-18-10-12-20(25)13-11-18/h8-13,15-16H,2-7,14,17H2,1H3,(H,27,29) |
| InChIKey | MFQINDPXHLEEGJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|