C22H15ClFN3O3 — CID 43996190
N-(5-chloro-2-hydroxyphenyl)-1-[(2-fluorophenyl)methyl]-2-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 43996190) has the molecular formula C22H15ClFN3O3 and a molecular weight of 423.83 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-1-[(2-fluorophenyl)methyl]-2-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-1-[(2-fluorophenyl)methyl]-2-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 43996190 |
| Molecular Formula | C22H15ClFN3O3 |
| Molecular Weight | 423.83 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-1-[(2-fluorophenyl)methyl]-2-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)c1cc2cccnc2n(Cc2ccccc2F)c1=O |
| InChI | InChI=1S/C22H15ClFN3O3/c23-15-7-8-19(28)18(11-15)26-21(29)16-10-13-5-3-9-25-20(13)27(22(16)30)12-14-4-1-2-6-17(14)24/h1-11,28H,12H2,(H,26,29) |
| InChIKey | GVFQCNZCBSBURS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.83 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|