C19H12FN5O4S — CID 43996202
1-[(2-fluorophenyl)methyl]-N-(5-nitro-1,3-thiazol-2-yl)-2-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 43996202) has the molecular formula C19H12FN5O4S and a molecular weight of 425.40 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-N-(5-nitro-1,3-thiazol-2-yl)-2-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-N-(5-nitro-1,3-thiazol-2-yl)-2-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 43996202 |
| Molecular Formula | C19H12FN5O4S |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-N-(5-nitro-1,3-thiazol-2-yl)-2-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1cc2cccnc2n(Cc2ccccc2F)c1=O |
| InChI | InChI=1S/C19H12FN5O4S/c20-14-6-2-1-4-12(14)10-24-16-11(5-3-7-21-16)8-13(18(24)27)17(26)23-19-22-9-15(30-19)25(28)29/h1-9H,10H2,(H,22,23,26) |
| InChIKey | HEQXUDZEXLLWNF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|