C18H12ClN5O2S2 — CID 43996367
1-[(4-chlorophenyl)methyl]-2-oxo-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxamide (PubChem CID 43996367) has the molecular formula C18H12ClN5O2S2 and a molecular weight of 429.91 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-oxo-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-oxo-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 43996367 |
| Molecular Formula | C18H12ClN5O2S2 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-oxo-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(Nc1n[nH]c(=S)s1)c1cc2cccnc2n(Cc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C18H12ClN5O2S2/c19-12-5-3-10(4-6-12)9-24-14-11(2-1-7-20-14)8-13(16(24)26)15(25)21-17-22-23-18(27)28-17/h1-8H,9H2,(H,23,27)(H,21,22,25) |
| InChIKey | QLPMOBDEPFLKGC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|