C23H22FN3O4S — CID 43997139
(E)-3-(1,3-benzodioxol-5-yl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide (PubChem CID 43997139) has the molecular formula C23H22FN3O4S and a molecular weight of 455.51 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 43997139 |
| Molecular Formula | C23H22FN3O4S |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)N(CCN1CCOCC1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C23H22FN3O4S/c24-17-3-4-18-21(14-17)32-23(25-18)27(8-7-26-9-11-29-12-10-26)22(28)6-2-16-1-5-19-20(13-16)31-15-30-19/h1-6,13-14H,7-12,15H2/b6-2+ |
| InChIKey | DFHSIDWOLMFGDL-QHHAFSJGSA-N |
| XLogP | 3.54 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|