C26H29N3O5S — CID 43999966
(E)-3-(1,3-benzodioxol-5-yl)-N-(4-ethoxy-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)prop-2-enamide (PubChem CID 43999966) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-(4-ethoxy-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(4-ethoxy-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 43999966 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(4-ethoxy-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)prop-2-enamide |
| SMILES | CCOc1cccc2sc(N(CCCN3CCOCC3)C(=O)/C=C/c3ccc4c(c3)OCO4)nc12 |
| InChI | InChI=1S/C26H29N3O5S/c1-2-32-21-5-3-6-23-25(21)27-26(35-23)29(12-4-11-28-13-15-31-16-14-28)24(30)10-8-19-7-9-20-22(17-19)34-18-33-20/h3,5-10,17H,2,4,11-16,18H2,1H3/b10-8+ |
| InChIKey | HZWATEYNWKJNKE-CSKARUKUSA-N |
| XLogP | 4.19 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|