About 3-Phenylpropyl 4-(aminomethyl)benzoate
3-Phenylpropyl 4-(aminomethyl)benzoate (PubChem CID 44365668) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-phenylpropyl 4-(aminomethyl)benzoate.
Molecular Properties
| Compound Name | 3-Phenylpropyl 4-(aminomethyl)benzoate |
| PubChem CID | 44365668 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-phenylpropyl 4-(aminomethyl)benzoate |
| SMILES | C1=CC=C(C=C1)CCCOC(=O)C2=CC=C(C=C2)CN |
| InChI | InChI=1S/C17H19NO2/c18-13-15-8-10-16(11-9-15)17(19)20-12-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-11H,4,7,12-13,18H2 |
| InChIKey | ZTQJTJBOVMTLIY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | 279 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-Phenylpropyl 4-(aminomethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Phenylpropyl 4-(aminomethyl)benzoate?
The IUPAC name of 3-Phenylpropyl 4-(aminomethyl)benzoate (CID 44365668) is 3-phenylpropyl 4-(aminomethyl)benzoate.
What is the SMILES notation for 3-Phenylpropyl 4-(aminomethyl)benzoate?
The canonical SMILES for 3-Phenylpropyl 4-(aminomethyl)benzoate is C1=CC=C(C=C1)CCCOC(=O)C2=CC=C(C=C2)CN.
What is the InChIKey of 3-Phenylpropyl 4-(aminomethyl)benzoate?
The InChIKey is ZTQJTJBOVMTLIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c18-13-15-8-10-16(11-9-15)17(19)20-12-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-11H,4,7,12-13,18H2.
What are the key properties of 3-Phenylpropyl 4-(aminomethyl)benzoate?
3-Phenylpropyl 4-(aminomethyl)benzoate has a molecular weight of 269.34 g/mol, XLogP of 2.90, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Phenylpropyl 4-(aminomethyl)benzoate is sourced from PubChem (CID 44365668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).