About tert-butyl 4-(aminomethyl)benzoate
tert-butyl 4-(aminomethyl)benzoate (PubChem CID 14514888) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is tert-butyl 4-(aminomethyl)benzoate.
Molecular Properties
| Compound Name | tert-butyl 4-(aminomethyl)benzoate |
| PubChem CID | 14514888 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | tert-butyl 4-(aminomethyl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(CN)cc1 |
| InChI | InChI=1S/C12H17NO2/c1-12(2,3)15-11(14)10-6-4-9(8-13)5-7-10/h4-7H,8,13H2,1-3H3 |
| InChIKey | YCEJUWBZSJVVNE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 4-(aminomethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(aminomethyl)benzoate?
The IUPAC name of tert-butyl 4-(aminomethyl)benzoate (CID 14514888) is tert-butyl 4-(aminomethyl)benzoate.
What is the SMILES notation for tert-butyl 4-(aminomethyl)benzoate?
The canonical SMILES for tert-butyl 4-(aminomethyl)benzoate is CC(C)(C)OC(=O)c1ccc(CN)cc1.
What is the InChIKey of tert-butyl 4-(aminomethyl)benzoate?
The InChIKey is YCEJUWBZSJVVNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-12(2,3)15-11(14)10-6-4-9(8-13)5-7-10/h4-7H,8,13H2,1-3H3.
What are the key properties of tert-butyl 4-(aminomethyl)benzoate?
tert-butyl 4-(aminomethyl)benzoate has a molecular weight of 207.27 g/mol, XLogP of 2.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(aminomethyl)benzoate is sourced from PubChem (CID 14514888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).