C31H52O — CID 44368022
2,2-Dimethyl-3-(3,7,12,20-tetramethyl-16-vinyl-henicosa-3,7,11,19-tetraenyl)-oxirane (PubChem CID 44368022) has the molecular formula C31H52O and a molecular weight of 440.70 g/mol. Its IUPAC name is 3-[(7E,11E)-16-ethenyl-3,7,12,20-tetramethylhenicosa-3,7,11,19-tetraenyl]-2,2-dimethyloxirane.
| Compound Name | 2,2-Dimethyl-3-(3,7,12,20-tetramethyl-16-vinyl-henicosa-3,7,11,19-tetraenyl)-oxirane |
|---|---|
| PubChem CID | 44368022 |
| Molecular Formula | C31H52O |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.40 |
| IUPAC Name | 3-[(7E,11E)-16-ethenyl-3,7,12,20-tetramethylhenicosa-3,7,11,19-tetraenyl]-2,2-dimethyloxirane |
| SMILES | CC(=CCCC(CCC/C(=C/CC/C=C(\C)/CCC=C(C)CCC1C(O1)(C)C)/C)C=C)C |
| InChI | InChI=1S/C31H52O/c1-9-29(21-12-15-25(2)3)22-14-20-27(5)17-11-10-16-26(4)18-13-19-28(6)23-24-30-31(7,8)32-30/h9,15-17,19,29-30H,1,10-14,18,20-24H2,2-8H3/b26-16+,27-17+,28-19? |
| InChIKey | UUGQMKYXGCLAAV-VZPZPIGOSA-N |
| XLogP | 10.90 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | 667 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|