C21H16N2O — CID 44415990
3-phenyl-3,4-dihydro-1H-[1,3]oxazino[4,5-c]acridine (PubChem CID 44415990) has the molecular formula C21H16N2O and a molecular weight of 312.40 g/mol. Its IUPAC name is 3-phenyl-3,4-dihydro-1H-[1,3]oxazino[4,5-c]acridine.
| Compound Name | 3-phenyl-3,4-dihydro-1H-[1,3]oxazino[4,5-c]acridine |
|---|---|
| PubChem CID | 44415990 |
| Molecular Formula | C21H16N2O |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 3-phenyl-3,4-dihydro-1H-[1,3]oxazino[4,5-c]acridine |
| SMILES | C1C2=C(C=CC3=CC4=CC=CC=C4N=C23)NC(O1)C5=CC=CC=C5 |
| InChI | InChI=1S/C21H16N2O/c1-2-6-14(7-3-1)21-23-19-11-10-16-12-15-8-4-5-9-18(15)22-20(16)17(19)13-24-21/h1-12,21,23H,13H2 |
| InChIKey | VUKMDNGUZFMBCL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 34.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | 436 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|