C16H20F3NO2 — CID 44438410
N-(heptan-2-yl)-4-(2,2,2-trifluoroacetyl)benzamide (PubChem CID 44438410) has the molecular formula C16H20F3NO2 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-heptan-2-yl-4-(2,2,2-trifluoroacetyl)benzamide.
| Compound Name | N-(heptan-2-yl)-4-(2,2,2-trifluoroacetyl)benzamide |
|---|---|
| PubChem CID | 44438410 |
| Molecular Formula | C16H20F3NO2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-heptan-2-yl-4-(2,2,2-trifluoroacetyl)benzamide |
| SMILES | CCCCCC(C)NC(=O)C1=CC=C(C=C1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H20F3NO2/c1-3-4-5-6-11(2)20-15(22)13-9-7-12(8-10-13)14(21)16(17,18)19/h7-11H,3-6H2,1-2H3,(H,20,22) |
| InChIKey | IWIIKEDJKAXLGA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | 374 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|