C25H34N4O4 — CID 44500602
1-[(2S,3S)-2-[(dimethylamino)methyl]-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-phenylurea (PubChem CID 44500602) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is 1-[(2S,3S)-2-[(dimethylamino)methyl]-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-phenylurea.
| Compound Name | 1-[(2S,3S)-2-[(dimethylamino)methyl]-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-phenylurea |
|---|---|
| PubChem CID | 44500602 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 1-[(2S,3S)-2-[(dimethylamino)methyl]-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-phenylurea |
| SMILES | C[C@H]1CN([C@@H](C)CO)C(=O)Cc2cc(NC(=O)Nc3ccccc3)ccc2O[C@@H]1CN(C)C |
| InChI | InChI=1S/C25H34N4O4/c1-17-14-29(18(2)16-30)24(31)13-19-12-21(10-11-22(19)33-23(17)15-28(3)4)27-25(32)26-20-8-6-5-7-9-20/h5-12,17-18,23,30H,13-16H2,1-4H3,(H2,26,27,32)/t17-,18-,23+/m0/s1 |
| InChIKey | VPMPLFBICILMPX-IUKKYPGJSA-N |
| XLogP | 3.04 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |