C31H36Cl2N4O4 — CID 44502007
1-[(2R,3S)-2-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-phenylurea (PubChem CID 44502007) has the molecular formula C31H36Cl2N4O4 and a molecular weight of 599.56 g/mol. Its IUPAC name is 1-[(2R,3S)-2-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-phenylurea.
| Compound Name | 1-[(2R,3S)-2-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-phenylurea |
|---|---|
| PubChem CID | 44502007 |
| Molecular Formula | C31H36Cl2N4O4 |
| Molecular Weight | 599.56 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 1-[(2R,3S)-2-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-phenylurea |
| SMILES | C[C@H](CO)N1C[C@H](C)[C@H](CN(C)Cc2ccc(Cl)c(Cl)c2)Oc2ccc(NC(=O)Nc3ccccc3)cc2CC1=O |
| InChI | InChI=1S/C31H36Cl2N4O4/c1-20-16-37(21(2)19-38)30(39)15-23-14-25(35-31(40)34-24-7-5-4-6-8-24)10-12-28(23)41-29(20)18-36(3)17-22-9-11-26(32)27(33)13-22/h4-14,20-21,29,38H,15-19H2,1-3H3,(H2,34,35,40)/t20-,21+,29-/m0/s1 |
| InChIKey | NVPPLKXTBFJQBP-FONBTEPMSA-N |
| XLogP | 5.92 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |