C31H44N4O6S — CID 44501633
1-cyclohexyl-3-[(2S,3R)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl-(4-methylphenyl)sulfonylamino]methyl]-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]urea (PubChem CID 44501633) has the molecular formula C31H44N4O6S and a molecular weight of 600.78 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2S,3R)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl-(4-methylphenyl)sulfonylamino]methyl]-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]urea.
| Compound Name | 1-cyclohexyl-3-[(2S,3R)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl-(4-methylphenyl)sulfonylamino]methyl]-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]urea |
|---|---|
| PubChem CID | 44501633 |
| Molecular Formula | C31H44N4O6S |
| Molecular Weight | 600.78 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | 1-cyclohexyl-3-[(2S,3R)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl-(4-methylphenyl)sulfonylamino]methyl]-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]urea |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C[C@H]2Oc3ccc(NC(=O)NC4CCCCC4)cc3CC(=O)N([C@H](C)CO)C[C@H]2C)cc1 |
| InChI | InChI=1S/C31H44N4O6S/c1-21-10-13-27(14-11-21)42(39,40)34(4)19-29-22(2)18-35(23(3)20-36)30(37)17-24-16-26(12-15-28(24)41-29)33-31(38)32-25-8-6-5-7-9-25/h10-16,22-23,25,29,36H,5-9,17-20H2,1-4H3,(H2,32,33,38)/t22-,23-,29-/m1/s1 |
| InChIKey | OIBNIXYGLLBYRK-VDWGHMIBSA-N |
| XLogP | 3.92 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.78 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |