C25H40N4O6S — CID 54613970
1-cyclohexyl-3-[(2R,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl(methylsulfonyl)amino]methyl]-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]urea (PubChem CID 54613970) has the molecular formula C25H40N4O6S and a molecular weight of 524.68 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2R,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl(methylsulfonyl)amino]methyl]-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]urea.
| Compound Name | 1-cyclohexyl-3-[(2R,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl(methylsulfonyl)amino]methyl]-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]urea |
|---|---|
| PubChem CID | 54613970 |
| Molecular Formula | C25H40N4O6S |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | 1-cyclohexyl-3-[(2R,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl(methylsulfonyl)amino]methyl]-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]urea |
| SMILES | C[C@@H]1CN([C@@H](C)CO)C(=O)Cc2cc(NC(=O)NC3CCCCC3)ccc2O[C@H]1CN(C)S(C)(=O)=O |
| InChI | InChI=1S/C25H40N4O6S/c1-17-14-29(18(2)16-30)24(31)13-19-12-21(27-25(32)26-20-8-6-5-7-9-20)10-11-22(19)35-23(17)15-28(3)36(4,33)34/h10-12,17-18,20,23,30H,5-9,13-16H2,1-4H3,(H2,26,27,32)/t17-,18+,23+/m1/s1 |
| InChIKey | OZTUDNKQBKDGLK-STSQHVNTSA-N |
| XLogP | 2.18 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |