C35H40N4O4 — CID 44502387
1-[(2R,3S)-2-[[benzyl(methyl)amino]methyl]-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-naphthalen-1-ylurea (PubChem CID 44502387) has the molecular formula C35H40N4O4 and a molecular weight of 580.73 g/mol. Its IUPAC name is 1-[(2R,3S)-2-[[benzyl(methyl)amino]methyl]-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-naphthalen-1-ylurea.
| Compound Name | 1-[(2R,3S)-2-[[benzyl(methyl)amino]methyl]-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 44502387 |
| Molecular Formula | C35H40N4O4 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | 1-[(2R,3S)-2-[[benzyl(methyl)amino]methyl]-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-3-naphthalen-1-ylurea |
| SMILES | C[C@H]1CN([C@@H](C)CO)C(=O)Cc2cc(NC(=O)Nc3cccc4ccccc34)ccc2O[C@H]1CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C35H40N4O4/c1-24-20-39(25(2)23-40)34(41)19-28-18-29(36-35(42)37-31-15-9-13-27-12-7-8-14-30(27)31)16-17-32(28)43-33(24)22-38(3)21-26-10-5-4-6-11-26/h4-18,24-25,33,40H,19-23H2,1-3H3,(H2,36,37,42)/t24-,25-,33-/m0/s1 |
| InChIKey | GCNTVXNBVJIYRL-TZNXZYKKSA-N |
| XLogP | 5.76 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |