C36H40N4O5 — CID 44504593
N-[(2S,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl(naphthalen-1-ylcarbamoyl)amino]methyl]-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-2-phenylacetamide (PubChem CID 44504593) has the molecular formula C36H40N4O5 and a molecular weight of 608.74 g/mol. Its IUPAC name is N-[(2S,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl(naphthalen-1-ylcarbamoyl)amino]methyl]-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-2-phenylacetamide.
| Compound Name | N-[(2S,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl(naphthalen-1-ylcarbamoyl)amino]methyl]-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 44504593 |
| Molecular Formula | C36H40N4O5 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | N-[(2S,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl(naphthalen-1-ylcarbamoyl)amino]methyl]-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-2-phenylacetamide |
| SMILES | C[C@@H]1CN([C@@H](C)CO)C(=O)Cc2cc(NC(=O)Cc3ccccc3)ccc2O[C@@H]1CN(C)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C36H40N4O5/c1-24-21-40(25(2)23-41)35(43)20-28-19-29(37-34(42)18-26-10-5-4-6-11-26)16-17-32(28)45-33(24)22-39(3)36(44)38-31-15-9-13-27-12-7-8-14-30(27)31/h4-17,19,24-25,33,41H,18,20-23H2,1-3H3,(H,37,42)(H,38,44)/t24-,25+,33-/m1/s1 |
| InChIKey | FXBHDARRFHJBOY-RNDKRWLGSA-N |
| XLogP | 5.33 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |