C32H41N3O4 — CID 44504174
(2S,3S)-9-(dimethylamino)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl-[(4-phenoxyphenyl)methyl]amino]methyl]-2,3,4,7-tetrahydro-1,5-benzoxazonin-6-one (PubChem CID 44504174) has the molecular formula C32H41N3O4 and a molecular weight of 531.70 g/mol. Its IUPAC name is (2S,3S)-9-(dimethylamino)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl-[(4-phenoxyphenyl)methyl]amino]methyl]-2,3,4,7-tetrahydro-1,5-benzoxazonin-6-one.
| Compound Name | (2S,3S)-9-(dimethylamino)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl-[(4-phenoxyphenyl)methyl]amino]methyl]-2,3,4,7-tetrahydro-1,5-benzoxazonin-6-one |
|---|---|
| PubChem CID | 44504174 |
| Molecular Formula | C32H41N3O4 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | (2S,3S)-9-(dimethylamino)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl-[(4-phenoxyphenyl)methyl]amino]methyl]-2,3,4,7-tetrahydro-1,5-benzoxazonin-6-one |
| SMILES | C[C@H]1CN([C@@H](C)CO)C(=O)Cc2cc(N(C)C)ccc2O[C@@H]1CN(C)Cc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C32H41N3O4/c1-23-19-35(24(2)22-36)32(37)18-26-17-27(33(3)4)13-16-30(26)39-31(23)21-34(5)20-25-11-14-29(15-12-25)38-28-9-7-6-8-10-28/h6-17,23-24,31,36H,18-22H2,1-5H3/t23-,24-,31+/m0/s1 |
| InChIKey | KPMYWLOWNANZDW-ISTJGCCRSA-N |
| XLogP | 4.83 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|