C27H39N3O4 — CID 54613958
(2R,3R)-9-(dimethylamino)-5-[(2S)-1-hydroxypropan-2-yl]-2-[[(4-methoxyphenyl)methyl-methylamino]methyl]-3-methyl-2,3,4,7-tetrahydro-1,5-benzoxazonin-6-one (PubChem CID 54613958) has the molecular formula C27H39N3O4 and a molecular weight of 469.63 g/mol. Its IUPAC name is (2R,3R)-9-(dimethylamino)-5-[(2S)-1-hydroxypropan-2-yl]-2-[[(4-methoxyphenyl)methyl-methylamino]methyl]-3-methyl-2,3,4,7-tetrahydro-1,5-benzoxazonin-6-one.
| Compound Name | (2R,3R)-9-(dimethylamino)-5-[(2S)-1-hydroxypropan-2-yl]-2-[[(4-methoxyphenyl)methyl-methylamino]methyl]-3-methyl-2,3,4,7-tetrahydro-1,5-benzoxazonin-6-one |
|---|---|
| PubChem CID | 54613958 |
| Molecular Formula | C27H39N3O4 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | (2R,3R)-9-(dimethylamino)-5-[(2S)-1-hydroxypropan-2-yl]-2-[[(4-methoxyphenyl)methyl-methylamino]methyl]-3-methyl-2,3,4,7-tetrahydro-1,5-benzoxazonin-6-one |
| SMILES | COc1ccc(CN(C)C[C@@H]2Oc3ccc(N(C)C)cc3CC(=O)N([C@@H](C)CO)C[C@H]2C)cc1 |
| InChI | InChI=1S/C27H39N3O4/c1-19-15-30(20(2)18-31)27(32)14-22-13-23(28(3)4)9-12-25(22)34-26(19)17-29(5)16-21-7-10-24(33-6)11-8-21/h7-13,19-20,26,31H,14-18H2,1-6H3/t19-,20+,26+/m1/s1 |
| InChIKey | PDTLFWMSVVXDKF-GOHWNWGWSA-N |
| XLogP | 3.04 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|