C27H47N3O4 — CID 44504552
(3R,9R,10S)-16-(dimethylamino)-12-[(2R)-1-hydroxypropan-2-yl]-3,10-dimethyl-9-[[methyl(propyl)amino]methyl]-2,8-dioxa-12-azabicyclo[12.4.0]octadeca-1(14),15,17-trien-13-one (PubChem CID 44504552) has the molecular formula C27H47N3O4 and a molecular weight of 477.69 g/mol. Its IUPAC name is (3R,9R,10S)-16-(dimethylamino)-12-[(2R)-1-hydroxypropan-2-yl]-3,10-dimethyl-9-[[methyl(propyl)amino]methyl]-2,8-dioxa-12-azabicyclo[12.4.0]octadeca-1(14),15,17-trien-13-one.
| Compound Name | (3R,9R,10S)-16-(dimethylamino)-12-[(2R)-1-hydroxypropan-2-yl]-3,10-dimethyl-9-[[methyl(propyl)amino]methyl]-2,8-dioxa-12-azabicyclo[12.4.0]octadeca-1(14),15,17-trien-13-one |
|---|---|
| PubChem CID | 44504552 |
| Molecular Formula | C27H47N3O4 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.36 |
| IUPAC Name | (3R,9R,10S)-16-(dimethylamino)-12-[(2R)-1-hydroxypropan-2-yl]-3,10-dimethyl-9-[[methyl(propyl)amino]methyl]-2,8-dioxa-12-azabicyclo[12.4.0]octadeca-1(14),15,17-trien-13-one |
| SMILES | CCCN(C)C[C@@H]1OCCCC[C@@H](C)Oc2ccc(N(C)C)cc2C(=O)N([C@H](C)CO)C[C@@H]1C |
| InChI | InChI=1S/C27H47N3O4/c1-8-14-29(7)18-26-20(2)17-30(21(3)19-31)27(32)24-16-23(28(5)6)12-13-25(24)34-22(4)11-9-10-15-33-26/h12-13,16,20-22,26,31H,8-11,14-15,17-19H2,1-7H3/t20-,21+,22+,26-/m0/s1 |
| InChIKey | KFCLPYACNRFGCM-BOCITWAFSA-N |
| XLogP | 3.89 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|