C32H47N3O6 — CID 44607860
4-[[[(3R,9R,10R)-16-(dimethylamino)-12-[(2S)-1-hydroxypropan-2-yl]-3,10-dimethyl-13-oxo-2,8-dioxa-12-azabicyclo[12.4.0]octadeca-1(14),15,17-trien-9-yl]methyl-methylamino]methyl]benzoic acid (PubChem CID 44607860) has the molecular formula C32H47N3O6 and a molecular weight of 569.74 g/mol. Its IUPAC name is 4-[[[(3R,9R,10R)-16-(dimethylamino)-12-[(2S)-1-hydroxypropan-2-yl]-3,10-dimethyl-13-oxo-2,8-dioxa-12-azabicyclo[12.4.0]octadeca-1(14),15,17-trien-9-yl]methyl-methylamino]methyl]benzoic acid.
| Compound Name | 4-[[[(3R,9R,10R)-16-(dimethylamino)-12-[(2S)-1-hydroxypropan-2-yl]-3,10-dimethyl-13-oxo-2,8-dioxa-12-azabicyclo[12.4.0]octadeca-1(14),15,17-trien-9-yl]methyl-methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 44607860 |
| Molecular Formula | C32H47N3O6 |
| Molecular Weight | 569.74 g/mol |
| Exact Mass | 569.35 |
| IUPAC Name | 4-[[[(3R,9R,10R)-16-(dimethylamino)-12-[(2S)-1-hydroxypropan-2-yl]-3,10-dimethyl-13-oxo-2,8-dioxa-12-azabicyclo[12.4.0]octadeca-1(14),15,17-trien-9-yl]methyl-methylamino]methyl]benzoic acid |
| SMILES | C[C@@H]1CCCCO[C@@H](CN(C)Cc2ccc(C(=O)O)cc2)[C@H](C)CN([C@@H](C)CO)C(=O)c2cc(N(C)C)ccc2O1 |
| InChI | InChI=1S/C32H47N3O6/c1-22-18-35(23(2)21-36)31(37)28-17-27(33(4)5)14-15-29(28)41-24(3)9-7-8-16-40-30(22)20-34(6)19-25-10-12-26(13-11-25)32(38)39/h10-15,17,22-24,30,36H,7-9,16,18-21H2,1-6H3,(H,38,39)/t22-,23+,24-,30+/m1/s1 |
| InChIKey | JGZXBABAHUXSMS-IFVFNEAISA-N |
| XLogP | 4.38 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.74 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|