C18H21N3O3 — CID 44507584
3-N-hydroxy-1-N-[(E)-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylideneamino]benzene-1,3-dicarboxamide (PubChem CID 44507584) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-N-hydroxy-1-N-[(E)-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylideneamino]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-hydroxy-1-N-[(E)-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylideneamino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 44507584 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-N-hydroxy-1-N-[(E)-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylideneamino]benzene-1,3-dicarboxamide |
| SMILES | C=C(C)[C@@H]1CC=C(/C=N/NC(=O)c2cccc(C(=O)NO)c2)CC1 |
| InChI | InChI=1S/C18H21N3O3/c1-12(2)14-8-6-13(7-9-14)11-19-20-17(22)15-4-3-5-16(10-15)18(23)21-24/h3-6,10-11,14,24H,1,7-9H2,2H3,(H,20,22)(H,21,23)/b19-11+/t14-/m1/s1 |
| InChIKey | ROOQWMPNNXUVTD-HIPSJFSSSA-N |
| XLogP | 2.82 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|