C14H19N3O6 — CID 44507599
3-N-hydroxy-1-N-[(E)-[(3S,4R,5R)-3,4,5-trihydroxyhexylidene]amino]benzene-1,3-dicarboxamide (PubChem CID 44507599) has the molecular formula C14H19N3O6 and a molecular weight of 325.32 g/mol. Its IUPAC name is 3-N-hydroxy-1-N-[(E)-[(3S,4R,5R)-3,4,5-trihydroxyhexylidene]amino]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-hydroxy-1-N-[(E)-[(3S,4R,5R)-3,4,5-trihydroxyhexylidene]amino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 44507599 |
| Molecular Formula | C14H19N3O6 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 3-N-hydroxy-1-N-[(E)-[(3S,4R,5R)-3,4,5-trihydroxyhexylidene]amino]benzene-1,3-dicarboxamide |
| SMILES | C[C@@H](O)[C@@H](O)[C@@H](O)C/C=N/NC(=O)c1cccc(C(=O)NO)c1 |
| InChI | InChI=1S/C14H19N3O6/c1-8(18)12(20)11(19)5-6-15-16-13(21)9-3-2-4-10(7-9)14(22)17-23/h2-4,6-8,11-12,18-20,23H,5H2,1H3,(H,16,21)(H,17,22)/b15-6+/t8-,11+,12-/m1/s1 |
| InChIKey | TUAVPOIZYGWENH-JRODLJFFSA-N |
| XLogP | -0.99 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|