C14H21NaO8 — CID 44511271
sodium (4S)-4-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate (PubChem CID 44511271) has the molecular formula C14H21NaO8 and a molecular weight of 340.30 g/mol. Its IUPAC name is sodium (4S)-4-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate.
| Compound Name | sodium (4S)-4-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate |
|---|---|
| PubChem CID | 44511271 |
| Molecular Formula | C14H21NaO8 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | sodium (4S)-4-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate |
| SMILES | CC1(C)O[C@H]([C@@H](O)CC(=O)C(=O)[O-])[C@@H]([C@H]2COC(C)(C)O2)O1.[Na+] |
| InChI | InChI=1S/C14H22O8.Na/c1-13(2)19-6-9(20-13)11-10(21-14(3,4)22-11)7(15)5-8(16)12(17)18;/h7,9-11,15H,5-6H2,1-4H3,(H,17,18);/q;+1/p-1/t7-,9+,10+,11+;/m0./s1 |
| InChIKey | LBCLDYZIFKNBMD-QQARXAIQSA-M |
| XLogP | -4.27 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|