C14H24O7Si — CID 44511281
[(3aR,5S,6S,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-trimethylsilylethyl carbonate (PubChem CID 44511281) has the molecular formula C14H24O7Si and a molecular weight of 332.43 g/mol. Its IUPAC name is [(3aR,5S,6S,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-trimethylsilylethyl carbonate.
| Compound Name | [(3aR,5S,6S,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-trimethylsilylethyl carbonate |
|---|---|
| PubChem CID | 44511281 |
| Molecular Formula | C14H24O7Si |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [(3aR,5S,6S,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-trimethylsilylethyl carbonate |
| SMILES | CC1(C)O[C@H]2O[C@H](C=O)[C@H](OC(=O)OCC[Si](C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C14H24O7Si/c1-14(2)20-11-10(9(8-15)18-12(11)21-14)19-13(16)17-6-7-22(3,4)5/h8-12H,6-7H2,1-5H3/t9-,10+,11-,12-/m1/s1 |
| InChIKey | WMQJGMHRAGUZLU-WRWGMCAJSA-N |
| XLogP | 1.92 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|