C11H16O8 — CID 44511292
(1S,2R,6R,8R,9S)-9,11-dihydroxy-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane-11-carboxylic acid (PubChem CID 44511292) has the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. Its IUPAC name is (1S,2R,6R,8R,9S)-9,11-dihydroxy-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane-11-carboxylic acid.
| Compound Name | (1S,2R,6R,8R,9S)-9,11-dihydroxy-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane-11-carboxylic acid |
|---|---|
| PubChem CID | 44511292 |
| Molecular Formula | C11H16O8 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (1S,2R,6R,8R,9S)-9,11-dihydroxy-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane-11-carboxylic acid |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](OC(O)(C(=O)O)C[C@@H]3O)[C@H]2O1 |
| InChI | InChI=1S/C11H16O8/c1-10(2)17-7-6-5(16-8(7)19-10)4(12)3-11(15,18-6)9(13)14/h4-8,12,15H,3H2,1-2H3,(H,13,14)/t4-,5+,6-,7+,8+,11?/m0/s1 |
| InChIKey | LDQOGVAIXNGPBS-JWEXUIRYSA-N |
| XLogP | -1.21 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |