C18H16ClN7O3 — CID 44511484
1-[4-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]oxy-2-chlorophenyl]-3-pyridin-4-ylurea (PubChem CID 44511484) has the molecular formula C18H16ClN7O3 and a molecular weight of 413.83 g/mol. Its IUPAC name is 1-[4-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]oxy-2-chlorophenyl]-3-pyridin-4-ylurea.
| Compound Name | 1-[4-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]oxy-2-chlorophenyl]-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 44511484 |
| Molecular Formula | C18H16ClN7O3 |
| Molecular Weight | 413.83 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 1-[4-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]oxy-2-chlorophenyl]-3-pyridin-4-ylurea |
| SMILES | CO/N=C/c1c(N)ncnc1Oc1ccc(NC(=O)Nc2ccncc2)c(Cl)c1 |
| InChI | InChI=1S/C18H16ClN7O3/c1-28-24-9-13-16(20)22-10-23-17(13)29-12-2-3-15(14(19)8-12)26-18(27)25-11-4-6-21-7-5-11/h2-10H,1H3,(H2,20,22,23)(H2,21,25,26,27)/b24-9+ |
| InChIKey | FUCCZEKBLJWUIX-PGGKNCGUSA-N |
| XLogP | 3.52 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|