C20H19ClN6O3 — CID 44511605
1-[4-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]oxy-2-chlorophenyl]-3-(3-methylphenyl)urea (PubChem CID 44511605) has the molecular formula C20H19ClN6O3 and a molecular weight of 426.86 g/mol. Its IUPAC name is 1-[4-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]oxy-2-chlorophenyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[4-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]oxy-2-chlorophenyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 44511605 |
| Molecular Formula | C20H19ClN6O3 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1-[4-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]oxy-2-chlorophenyl]-3-(3-methylphenyl)urea |
| SMILES | CO/N=C/c1c(N)ncnc1Oc1ccc(NC(=O)Nc2cccc(C)c2)c(Cl)c1 |
| InChI | InChI=1S/C20H19ClN6O3/c1-12-4-3-5-13(8-12)26-20(28)27-17-7-6-14(9-16(17)21)30-19-15(10-25-29-2)18(22)23-11-24-19/h3-11H,1-2H3,(H2,22,23,24)(H2,26,27,28)/b25-10+ |
| InChIKey | XMXAHOLONWPAOQ-KIBLKLHPSA-N |
| XLogP | 4.44 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|