C19H23ClN6O3 — CID 67413598
methyl 4-amino-6-[3-chloro-4-(cyclohexylcarbamoylamino)phenoxy]pyrimidine-5-carboximidate (PubChem CID 67413598) has the molecular formula C19H23ClN6O3 and a molecular weight of 418.89 g/mol. Its IUPAC name is methyl 4-amino-6-[3-chloro-4-(cyclohexylcarbamoylamino)phenoxy]pyrimidine-5-carboximidate.
| Compound Name | methyl 4-amino-6-[3-chloro-4-(cyclohexylcarbamoylamino)phenoxy]pyrimidine-5-carboximidate |
|---|---|
| PubChem CID | 67413598 |
| Molecular Formula | C19H23ClN6O3 |
| Molecular Weight | 418.89 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | methyl 4-amino-6-[3-chloro-4-(cyclohexylcarbamoylamino)phenoxy]pyrimidine-5-carboximidate |
| SMILES | [H]/N=C(\OC)c1c(N)ncnc1Oc1ccc(NC(=O)NC2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C19H23ClN6O3/c1-28-17(22)15-16(21)23-10-24-18(15)29-12-7-8-14(13(20)9-12)26-19(27)25-11-5-3-2-4-6-11/h7-11,22H,2-6H2,1H3,(H2,21,23,24)(H2,25,26,27)/b22-17- |
| InChIKey | KNATWYVSTFGUIM-XLNRJJMWSA-N |
| XLogP | 3.93 |
| TPSA | 135.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.89 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|