C25H21F2N5O3 — CID 44512939
5-(3,5-difluorophenyl)-3-[(1S)-1-[3-(2-methoxyethoxy)quinolin-6-yl]ethyl]triazolo[4,5-c]pyridin-4-one (PubChem CID 44512939) has the molecular formula C25H21F2N5O3 and a molecular weight of 477.47 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)-3-[(1S)-1-[3-(2-methoxyethoxy)quinolin-6-yl]ethyl]triazolo[4,5-c]pyridin-4-one.
| Compound Name | 5-(3,5-difluorophenyl)-3-[(1S)-1-[3-(2-methoxyethoxy)quinolin-6-yl]ethyl]triazolo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 44512939 |
| Molecular Formula | C25H21F2N5O3 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 5-(3,5-difluorophenyl)-3-[(1S)-1-[3-(2-methoxyethoxy)quinolin-6-yl]ethyl]triazolo[4,5-c]pyridin-4-one |
| SMILES | COCCOc1cnc2ccc([C@H](C)n3nnc4ccn(-c5cc(F)cc(F)c5)c(=O)c43)cc2c1 |
| InChI | InChI=1S/C25H21F2N5O3/c1-15(16-3-4-22-17(9-16)10-21(14-28-22)35-8-7-34-2)32-24-23(29-30-32)5-6-31(25(24)33)20-12-18(26)11-19(27)13-20/h3-6,9-15H,7-8H2,1-2H3/t15-/m0/s1 |
| InChIKey | NKKSQKKEWMSMOE-HNNXBMFYSA-N |
| XLogP | 4.04 |
| TPSA | 84.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|