C9H18O3 — CID 44513722
(3S,4R)-4-(methoxymethoxy)-3-methylhex-1-en-3-ol (PubChem CID 44513722) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is (3S,4R)-4-(methoxymethoxy)-3-methylhex-1-en-3-ol.
| Compound Name | (3S,4R)-4-(methoxymethoxy)-3-methylhex-1-en-3-ol |
|---|---|
| PubChem CID | 44513722 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | (3S,4R)-4-(methoxymethoxy)-3-methylhex-1-en-3-ol |
| SMILES | C=C[C@](C)(O)[C@@H](CC)OCOC |
| InChI | InChI=1S/C9H18O3/c1-5-8(12-7-11-4)9(3,10)6-2/h6,8,10H,2,5,7H2,1,3-4H3/t8-,9+/m1/s1 |
| InChIKey | VAKWGFYCAHVZBS-BDAKNGLRSA-N |
| XLogP | 1.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|